CAS 1629614-02-3 is the registry number for 5–(3,5–Dimethyl–1,2–oxazol–4–yl)–3–iodo–1,2–benzenediamine. Offered by: GLPBio. Available pack sizes: 10mg, 50mg.
5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-iodobenzene-1,2-diamine (CAS 1629614-02-3) is a chemical compound with the molecular formula C11H12IN3O and a molecular weight of 329.14 g/mol. IUPAC name: 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-iodobenzene-1,2-diamine. InChIKey: GHKITNQCVVUGJH-UHFFFAOYSA-N.
| Molecular formula | C11H12IN3O |
|---|---|
| Molecular weight | 329.14 g/mol |
| IUPAC name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-iodobenzene-1,2-diamine |
| InChIKey | GHKITNQCVVUGJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC(=C(C(=C2)I)N)N |
Computed by PubChem (NCBI)