CAS 2360909-50-6 appears in our catalog under these names: PD–1–IN–24, PD-1-IN-24, 98.04%, 98.04%, PD-1-IN-24, 98.12%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 10mM (in 1ml dmso), 5mg, 1mg, 25 mg, 5 mg, 10mM/1mL, 50 mg.
(2S)-3-hydroxy-2-methyl-2-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylamino]propanoic acid (CAS 2360909-50-6) is a chemical compound with the molecular formula C27H26F3NO3 and a molecular weight of 469.5 g/mol. IUPAC name: (2S)-3-hydroxy-2-methyl-2-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylamino]propanoic acid. InChIKey: ITARRJJJADSSAW-JYSHFMIGSA-N.
| Molecular formula | C27H26F3NO3 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | (2S)-3-hydroxy-2-methyl-2-[[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methylamino]propanoic acid |
| InChIKey | ITARRJJJADSSAW-JYSHFMIGSA-N |
| SMILES | CC1=C(C=CC=C1C2=CC=CC=C2)/C=C/C3=C(C=CC(=C3)CN[C@@](C)(CO)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)