Products 2361012-66-8
CAS 2361012-66-8 is the registry number for 2-(4-fluorobenzyl)-1,3,5-trimethylbenzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[(4-fluorophenyl)methyl]-1,3,5-trimethylbenzene (CAS 2361012-66-8) is a chemical compound with the molecular formula C16H17F and a molecular weight of 228.30 g/mol. IUPAC name: 2-[(4-fluorophenyl)methyl]-1,3,5-trimethylbenzene. InChIKey: HHHCOAQGQIJJNG-UHFFFAOYSA-N.
| Molecular formula | C16H17F |
|---|---|
| Molecular weight | 228.30 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methyl]-1,3,5-trimethylbenzene |
| InChIKey | HHHCOAQGQIJJNG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)