Products 2361124-03-8
CAS 2361124-03-8 is the registry number for Claziprotamidum. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-2-(4-cyclopropyl-3-fluorophenyl)ethanone (CAS 2361124-03-8) is a chemical compound with the molecular formula C19H20ClFN4O and a molecular weight of 374.8 g/mol. IUPAC name: 1-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-2-(4-cyclopropyl-3-fluorophenyl)ethanone. InChIKey: GGZFNPBICDFCKG-UHFFFAOYSA-N.
| Molecular formula | C19H20ClFN4O |
|---|---|
| Molecular weight | 374.8 g/mol |
| IUPAC name | 1-[4-(6-chloropyridazin-3-yl)piperazin-1-yl]-2-(4-cyclopropyl-3-fluorophenyl)ethanone |
| InChIKey | GGZFNPBICDFCKG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=C(C=C2)CC(=O)N3CCN(CC3)C4=NN=C(C=C4)Cl)F |
Computed by PubChem (NCBI)