CAS 2361304-26-7 appears in our catalog under these names: STAT3-IN-3, 98%, STAT3-IN-3, STAT3-IN-3, 98.40%. Offered by: AmBeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 1mg, 5mg, 10mg, 25 mg, 100 mg.
3-[4-(4-bromo-1,1-dioxo-1-benzothiophene-2-carbonyl)piperazine-1-carbonyl]-7-(diethylamino)chromen-2-one (CAS 2361304-26-7) is a chemical compound with the molecular formula C27H26BrN3O6S and a molecular weight of 600.5 g/mol. IUPAC name: 3-[4-(4-bromo-1,1-dioxo-1-benzothiophene-2-carbonyl)piperazine-1-carbonyl]-7-(diethylamino)chromen-2-one. InChIKey: LEVMMUZFAXTJOJ-UHFFFAOYSA-N.
| Molecular formula | C27H26BrN3O6S |
|---|---|
| Molecular weight | 600.5 g/mol |
| IUPAC name | 3-[4-(4-bromo-1,1-dioxo-1-benzothiophene-2-carbonyl)piperazine-1-carbonyl]-7-(diethylamino)chromen-2-one |
| InChIKey | LEVMMUZFAXTJOJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)N3CCN(CC3)C(=O)C4=CC5=C(S4(=O)=O)C=CC=C5Br |
Computed by PubChem (NCBI)