CAS 2361310-65-6 is the registry number for 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2361310-65-6) is a chemical compound with the molecular formula C13H19BO3 and a molecular weight of 234.10 g/mol. IUPAC name: 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: TXTUCPAGIQLJRX-UHFFFAOYSA-N.
| Molecular formula | C13H19BO3 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | TXTUCPAGIQLJRX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2O)C |
Computed by PubChem (NCBI)