CAS 2361608-67-3 is the registry number for (2R)-1-{((2R)-2-Hydroxybutyl)(methyl)amino}butan-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R)-1-[[(2R)-2-hydroxybutyl]-methylamino]butan-2-ol (CAS 2361608-67-3) is a chemical compound with the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. IUPAC name: (2R)-1-[[(2R)-2-hydroxybutyl]-methylamino]butan-2-ol. InChIKey: GXMPGTXMVQAVAL-RKDXNWHRSA-N.
| Molecular formula | C9H21NO2 |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (2R)-1-[[(2R)-2-hydroxybutyl]-methylamino]butan-2-ol |
| InChIKey | GXMPGTXMVQAVAL-RKDXNWHRSA-N |
| SMILES | CC[C@H](CN(C)C[C@@H](CC)O)O |
Computed by PubChem (NCBI)