Products 2361609-36-9
CAS 2361609-36-9 is the registry number for rac-(1R,2S)-2-(3-(Methoxymethyl)-1,2,4-oxadiazol-5-yl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1S,2R)-2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboxylic acid (CAS 2361609-36-9) is a chemical compound with the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. IUPAC name: cis-(1S,2R)-2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboxylic acid. InChIKey: SXTORAOVWDCQGF-UHNVWZDZSA-N.
| Molecular formula | C8H10N2O4 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | cis-(1S,2R)-2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]cyclopropane-1-carboxylic acid |
| InChIKey | SXTORAOVWDCQGF-UHNVWZDZSA-N |
| SMILES | COCC1=NOC(=N1)[C@@H]2C[C@@H]2C(=O)O |
Computed by PubChem (NCBI)