CAS 2361641-15-6 is the registry number for 3-((3,3-Difluorocyclobutyl)methoxy)pyridin-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(3,3-difluorocyclobutyl)methoxy]pyridin-2-amine;hydrochloride (CAS 2361641-15-6) is a chemical compound with the molecular formula C10H13ClF2N2O and a molecular weight of 250.67 g/mol. IUPAC name: 3-[(3,3-difluorocyclobutyl)methoxy]pyridin-2-amine;hydrochloride. InChIKey: CXQHTNODCCBYKD-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF2N2O |
|---|---|
| Molecular weight | 250.67 g/mol |
| IUPAC name | 3-[(3,3-difluorocyclobutyl)methoxy]pyridin-2-amine;hydrochloride |
| InChIKey | CXQHTNODCCBYKD-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)COC2=C(N=CC=C2)N.Cl |
Computed by PubChem (NCBI)