CAS 2361645-28-3 is the registry number for 3-Bromoazetidine trifluoroacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-bromoazetidine;2,2,2-trifluoroacetic acid (CAS 2361645-28-3) is a chemical compound with the molecular formula C5H7BrF3NO2 and a molecular weight of 250.01 g/mol. IUPAC name: 3-bromoazetidine;2,2,2-trifluoroacetic acid. InChIKey: QOGPLZUNZXZZAV-UHFFFAOYSA-N.
| Molecular formula | C5H7BrF3NO2 |
|---|---|
| Molecular weight | 250.01 g/mol |
| IUPAC name | 3-bromoazetidine;2,2,2-trifluoroacetic acid |
| InChIKey | QOGPLZUNZXZZAV-UHFFFAOYSA-N |
| SMILES | C1C(CN1)Br.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)