Products 2361645-28-3

CAS 2361645-28-3 is the registry number for 3-Bromoazetidine trifluoroacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-bromoazetidine;2,2,2-trifluoroacetic acid (CAS 2361645-28-3) is a chemical compound with the molecular formula C5H7BrF3NO2 and a molecular weight of 250.01 g/mol. IUPAC name: 3-bromoazetidine;2,2,2-trifluoroacetic acid. InChIKey: QOGPLZUNZXZZAV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7BrF3NO2
Molecular weight250.01 g/mol
IUPAC name3-bromoazetidine;2,2,2-trifluoroacetic acid
InChIKeyQOGPLZUNZXZZAV-UHFFFAOYSA-N
SMILESC1C(CN1)Br.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)