CAS 2361679-26-5 is the registry number for Ethyl 3-(azetidin-3-yl)-1H-1,2,4-triazole-5-carboxylate dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 5-(azetidin-3-yl)-1H-1,2,4-triazole-3-carboxylate;dihydrochloride (CAS 2361679-26-5) is a chemical compound with the molecular formula C8H14Cl2N4O2 and a molecular weight of 269.13 g/mol. IUPAC name: ethyl 5-(azetidin-3-yl)-1H-1,2,4-triazole-3-carboxylate;dihydrochloride. InChIKey: DMXWELJFRMFSQL-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4O2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | ethyl 5-(azetidin-3-yl)-1H-1,2,4-triazole-3-carboxylate;dihydrochloride |
| InChIKey | DMXWELJFRMFSQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NNC(=N1)C2CNC2.Cl.Cl |
Computed by PubChem (NCBI)