Products 2361742-30-3
CAS 2361742-30-3 appears in our catalog under these names: VPC–70619, VPC-70619, 99.93%, VPC-70619, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 10 mg, 50 mg, 25 mg, 5 mg.
3-chloro-4-cyano-N'-[4-cyano-2-(trifluoromethyl)phenyl]benzohydrazide (CAS 2361742-30-3) is a chemical compound with the molecular formula C16H8ClF3N4O and a molecular weight of 364.71 g/mol. IUPAC name: 3-chloro-4-cyano-N'-[4-cyano-2-(trifluoromethyl)phenyl]benzohydrazide. InChIKey: XTKCWHGATOSBEH-UHFFFAOYSA-N.
| Molecular formula | C16H8ClF3N4O |
|---|---|
| Molecular weight | 364.71 g/mol |
| IUPAC name | 3-chloro-4-cyano-N'-[4-cyano-2-(trifluoromethyl)phenyl]benzohydrazide |
| InChIKey | XTKCWHGATOSBEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(F)(F)F)NNC(=O)C2=CC(=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)