CAS 2361775-33-7 is the registry number for [Amino(diphenylamino)methylidene]azanium iodide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1,1-diphenylguanidine;hydroiodide (CAS 2361775-33-7) is a chemical compound with the molecular formula C13H14IN3 and a molecular weight of 339.17 g/mol. IUPAC name: 1,1-diphenylguanidine;hydroiodide. InChIKey: NUUJHFUZXBVZKO-UHFFFAOYSA-N.
| Molecular formula | C13H14IN3 |
|---|---|
| Molecular weight | 339.17 g/mol |
| IUPAC name | 1,1-diphenylguanidine;hydroiodide |
| InChIKey | NUUJHFUZXBVZKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=N)N.I |
Computed by PubChem (NCBI)