Products 2361924-14-1
CAS 2361924-14-1 is the registry number for tert-Butyl (1R,6R)-1-amino-3-azabicyclo[4.1.0]heptane-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,6R)-1-amino-3-azabicyclo[4.1.0]heptane-3-carboxylate (CAS 2361924-14-1) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1R,6R)-1-amino-3-azabicyclo[4.1.0]heptane-3-carboxylate. InChIKey: WVHBMTCLKVJTOE-KCJUWKMLSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1R,6R)-1-amino-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| InChIKey | WVHBMTCLKVJTOE-KCJUWKMLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2C[C@@]2(C1)N |
Computed by PubChem (NCBI)