Products 2361949-85-9
CAS 2361949-85-9 is the registry number for tert-Butyl 8-imino-8-oxo-8λ6-thia-2-azaspiro(4.5)decane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 8-imino-8-oxo-8lambda6-thia-2-azaspiro[4.5]decane-2-carboxylate (CAS 2361949-85-9) is a chemical compound with the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. IUPAC name: tert-butyl 8-imino-8-oxo-8lambda6-thia-2-azaspiro[4.5]decane-2-carboxylate. InChIKey: YMMXVUOIKJWIQM-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O3S |
|---|---|
| Molecular weight | 288.41 g/mol |
| IUPAC name | tert-butyl 8-imino-8-oxo-8lambda6-thia-2-azaspiro[4.5]decane-2-carboxylate |
| InChIKey | YMMXVUOIKJWIQM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCS(=N)(=O)CC2 |
Computed by PubChem (NCBI)