CAS 2362-68-7 is the registry number for 4-(4-Methoxyphenyl)-2-phenylthiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
4-(4-methoxyphenyl)-2-phenyl-1,3-thiazole (CAS 2362-68-7) is a chemical compound with the molecular formula C16H13NOS and a molecular weight of 267.3 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2-phenyl-1,3-thiazole. InChIKey: FLAVQQJWQLDXLW-UHFFFAOYSA-N.
| Molecular formula | C16H13NOS |
|---|---|
| Molecular weight | 267.3 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-2-phenyl-1,3-thiazole |
| InChIKey | FLAVQQJWQLDXLW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CSC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)