CAS 23623-06-5 appears in our catalog under these names: HOE 32021, 98+%, HOE 32021, HOE 32021, 99.48%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1g, 2mg, 5mg, 1mg, 10mg, 25mg, 50mg, 10 mg.
2-(4-methoxyphenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole (CAS 23623-06-5) is a chemical compound with the molecular formula C26H26N6O and a molecular weight of 438.5 g/mol. IUPAC name: 2-(4-methoxyphenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole. InChIKey: ZEEIKPHYGCYRRH-UHFFFAOYSA-N.
| Molecular formula | C26H26N6O |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
| InChIKey | ZEEIKPHYGCYRRH-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC=C(C=C6)OC |
Computed by PubChem (NCBI)