CAS 2363172-64-7 appears in our catalog under these names: Palbociclib Impurity 89, Palbociclib Impurity 58. Offered by: Chemat Brand. Available pack sizes: on request.
6-acetyl-2-[(5-amino-2-pyridinyl)amino]-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one (CAS 2363172-64-7) is a chemical compound with the molecular formula C20H22N6O2 and a molecular weight of 378.4 g/mol. IUPAC name: 6-acetyl-2-[(5-amino-2-pyridinyl)amino]-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one. InChIKey: NYKGBFDGTNLBKR-UHFFFAOYSA-N.
| Molecular formula | C20H22N6O2 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 6-acetyl-2-[(5-amino-2-pyridinyl)amino]-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
| InChIKey | NYKGBFDGTNLBKR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N)C4CCCC4)C(=O)C |
Computed by PubChem (NCBI)