Products 2597345-07-6

CAS 2597345-07-6 is the registry number for UR241-2. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

N-(2-methoxy-4-piperazin-1-ylphenyl)-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide (CAS 2597345-07-6) is a chemical compound with the molecular formula C20H22N6O2 and a molecular weight of 378.4 g/mol. IUPAC name: N-(2-methoxy-4-piperazin-1-ylphenyl)-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide. InChIKey: PLPQYRICJPQFMT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22N6O2
Molecular weight378.4 g/mol
IUPAC nameN-(2-methoxy-4-piperazin-1-ylphenyl)-6-(1H-pyrazol-5-yl)pyridine-2-carboxamide
InChIKeyPLPQYRICJPQFMT-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)N2CCNCC2)NC(=O)C3=CC=CC(=N3)C4=CC=NN4

Computed by PubChem (NCBI)