Products 23635-14-5
CAS 23635-14-5 appears in our catalog under these names: (S)–(–)–Perillic acid, (S)-(-)-Perillic acid, 95%, Perillic Acid, (S)-(-)-Perillic acid 95%, (S)-(-)-Perillic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 5mg, 100mg, 250mg, 1g, 1mg, 10mM (in 1ml dmso), 10mM/1mL, 50 mg.
(4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylic acid (CAS 23635-14-5) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylic acid. InChIKey: CDSMSBUVCWHORP-MRVPVSSYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylic acid |
| InChIKey | CDSMSBUVCWHORP-MRVPVSSYSA-N |
| SMILES | CC(=C)[C@H]1CCC(=CC1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(S)-(-)-Perillic acid, (4S)-4-isopropenylcyclohexene-1-carboxylic acid, 1-Cyclohexene-1-carboxylic acid, 4-(1-methylethenyl)-, (4S)-, 4-Isopropenylcyclohexene-1-carboxylic acid, Lopac-P-7083, (4S)-4-prop-1-en-2-ylcyclohexene-1-carboxylic acid, (S)-()-Perillic acid, (S)-4-(prop-1-en-2-yl)cyclohex-1-enecarboxylic acid, (s)-(-)perillic acid, (S)-(-)-Perillicacid