CAS 2363757-18-8 is the registry number for tert-Butyl 2,4-dioxo-3-(pyridin-4-yl)-1,3,8-triazaspiro[4.5]decane-8-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,4-dioxo-3-pyridin-4-yl-1,3,8-triazaspiro[4.5]decane-8-carboxylate (CAS 2363757-18-8) is a chemical compound with the molecular formula C17H22N4O4 and a molecular weight of 346.4 g/mol. IUPAC name: tert-butyl 2,4-dioxo-3-pyridin-4-yl-1,3,8-triazaspiro[4.5]decane-8-carboxylate. InChIKey: BCQCOMPNYWMCFC-UHFFFAOYSA-N.
| Molecular formula | C17H22N4O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | tert-butyl 2,4-dioxo-3-pyridin-4-yl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| InChIKey | BCQCOMPNYWMCFC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(=O)N(C(=O)N2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)