CAS 2363781-71-7 is the registry number for 5-Bromo-2-fluoropyridine-3,4,6-d3. Offered by: TRC. Available pack sizes: 50mg.
3-bromo-2,4,5-trideuterio-6-fluoropyridine (CAS 2363781-71-7) is a chemical compound with the molecular formula C5H3BrFN and a molecular weight of 179.00 g/mol. IUPAC name: 3-bromo-2,4,5-trideuterio-6-fluoropyridine. InChIKey: MYUQKYGWKHTRPG-CBYSEHNBSA-N.
| Molecular formula | C5H3BrFN |
|---|---|
| Molecular weight | 179.00 g/mol |
| IUPAC name | 3-bromo-2,4,5-trideuterio-6-fluoropyridine |
| InChIKey | MYUQKYGWKHTRPG-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1Br)[2H])F)[2H] |
Computed by PubChem (NCBI)