Products 2363789-19-7
CAS 2363789-19-7 appears in our catalog under these names: (±)-2-Methyl-d3-piperazine-2,3,3,5,5,6,6-d7, 99 atom % D, min 98% Chemical Purity, 2-Methylpiperazine-d10. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
2,2,3,3,5,5,6-heptadeuterio-6-(trideuteriomethyl)piperazine (CAS 2363789-19-7) is a chemical compound with the molecular formula C5H12N2 and a molecular weight of 110.22 g/mol. IUPAC name: 2,2,3,3,5,5,6-heptadeuterio-6-(trideuteriomethyl)piperazine. InChIKey: JOMNTHCQHJPVAZ-NWURLDAXSA-N.
| Molecular formula | C5H12N2 |
|---|---|
| Molecular weight | 110.22 g/mol |
| IUPAC name | 2,2,3,3,5,5,6-heptadeuterio-6-(trideuteriomethyl)piperazine |
| InChIKey | JOMNTHCQHJPVAZ-NWURLDAXSA-N |
| SMILES | [2H]C1(C(NC(C(N1)([2H])[2H])([2H])C([2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)