CAS 2364352-64-5 is the registry number for N-Methyl-d3-7-azaindole. Offered by: TRC. Available pack sizes: 250mg.
1-(trideuteriomethyl)pyrrolo[2,3-b]pyridine (CAS 2364352-64-5) is a chemical compound with the molecular formula C8H8N2 and a molecular weight of 135.18 g/mol. IUPAC name: 1-(trideuteriomethyl)pyrrolo[2,3-b]pyridine. InChIKey: ZVOCBNCKNQJAFL-FIBGUPNXSA-N.
| Molecular formula | C8H8N2 |
|---|---|
| Molecular weight | 135.18 g/mol |
| IUPAC name | 1-(trideuteriomethyl)pyrrolo[2,3-b]pyridine |
| InChIKey | ZVOCBNCKNQJAFL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=CC2=C1N=CC=C2 |
Computed by PubChem (NCBI)