CAS 2364584-64-3 is the registry number for 5-(2,3-Dichloro-6-(trifluoromethyl)phenyl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
5-[2,3-dichloro-6-(trifluoromethyl)phenyl]-1,3-oxazole (CAS 2364584-64-3) is a chemical compound with the molecular formula C10H4Cl2F3NO and a molecular weight of 282.04 g/mol. IUPAC name: 5-[2,3-dichloro-6-(trifluoromethyl)phenyl]-1,3-oxazole. InChIKey: XQQZDCFEIBWQKZ-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2F3NO |
|---|---|
| Molecular weight | 282.04 g/mol |
| IUPAC name | 5-[2,3-dichloro-6-(trifluoromethyl)phenyl]-1,3-oxazole |
| InChIKey | XQQZDCFEIBWQKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)C2=CN=CO2)Cl)Cl |
Computed by PubChem (NCBI)