CAS 2365173-78-8 appears in our catalog under these names: Potassium trifluoro(oxetan-3-ylidenemethyl)borate, 98%, Potassium trifluoro((oxetan-3-ylidene)methyl)boranuide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Potassium trifluoro(oxetan-3-ylidenemethyl)boranuide (CAS 2365173-78-8) is a chemical compound with the molecular formula C4H5BF3KO and a molecular weight of 175.99 g/mol. IUPAC name: potassium trifluoro(oxetan-3-ylidenemethyl)boranuide. InChIKey: OQXPCOBMNFOBMX-UHFFFAOYSA-N.
| Molecular formula | C4H5BF3KO |
|---|---|
| Molecular weight | 175.99 g/mol |
| IUPAC name | potassium trifluoro(oxetan-3-ylidenemethyl)boranuide |
| InChIKey | OQXPCOBMNFOBMX-UHFFFAOYSA-N |
| SMILES | [B-](C=C1COC1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)