CAS 2365173-84-6 is the registry number for 4-((4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)methylene)piperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine (CAS 2365173-84-6) is a chemical compound with the molecular formula C12H22BNO2 and a molecular weight of 223.12 g/mol. IUPAC name: 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine. InChIKey: LKBLOFBYILPVKQ-UHFFFAOYSA-N.
| Molecular formula | C12H22BNO2 |
|---|---|
| Molecular weight | 223.12 g/mol |
| IUPAC name | 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]piperidine |
| InChIKey | LKBLOFBYILPVKQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2CCNCC2 |
Computed by PubChem (NCBI)