CAS 2365418-06-8 is the registry number for 2-Amino-n,n-dimethyl-butyramide oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-N,N-dimethylbutanamide;oxalic acid (CAS 2365418-06-8) is a chemical compound with the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. IUPAC name: 2-amino-N,N-dimethylbutanamide;oxalic acid. InChIKey: VUVSMDYPYIXWQD-UHFFFAOYSA-N.
| Molecular formula | C8H16N2O5 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2-amino-N,N-dimethylbutanamide;oxalic acid |
| InChIKey | VUVSMDYPYIXWQD-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)N(C)C)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)