CAS 2365418-74-0 appears in our catalog under these names: N-(3,5-Dichloropyridin-4-yl)-3,4-difluorobenzamide, 96%, N-(3,5-DIchloropyridin-4-yl)-3,4-difluorobenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(3,5-dichloro-4-pyridinyl)-3,4-difluorobenzamide (CAS 2365418-74-0) is a chemical compound with the molecular formula C12H6Cl2F2N2O and a molecular weight of 303.09 g/mol. IUPAC name: N-(3,5-dichloro-4-pyridinyl)-3,4-difluorobenzamide. InChIKey: LSYFJQZTFUCZQC-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2F2N2O |
|---|---|
| Molecular weight | 303.09 g/mol |
| IUPAC name | N-(3,5-dichloro-4-pyridinyl)-3,4-difluorobenzamide |
| InChIKey | LSYFJQZTFUCZQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NC2=C(C=NC=C2Cl)Cl)F)F |
Computed by PubChem (NCBI)