CAS 2365418-76-2 appears in our catalog under these names: 1-(5-Bromo-2-fluoro-3-methoxyphenyl)-2,2,2-trifluoroethanol, 95%, 1-(5-Bromo-2-fluoro-3-methoxyphenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-(5-bromo-2-fluoro-3-methoxyphenyl)-2,2,2-trifluoroethanol (CAS 2365418-76-2) is a chemical compound with the molecular formula C9H7BrF4O2 and a molecular weight of 303.05 g/mol. IUPAC name: 1-(5-bromo-2-fluoro-3-methoxyphenyl)-2,2,2-trifluoroethanol. InChIKey: LDIRMOYYUHDAAN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF4O2 |
|---|---|
| Molecular weight | 303.05 g/mol |
| IUPAC name | 1-(5-bromo-2-fluoro-3-methoxyphenyl)-2,2,2-trifluoroethanol |
| InChIKey | LDIRMOYYUHDAAN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1F)C(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)