CAS 2365420-02-4 appears in our catalog under these names: 1-(4-Bromophenoxy)-3,5-difluorobenzene, 96%, 1-(4-Bromophenoxy)-3,5-difluorobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
1-(4-bromophenoxy)-3,5-difluorobenzene (CAS 2365420-02-4) is a chemical compound with the molecular formula C12H7BrF2O and a molecular weight of 285.08 g/mol. IUPAC name: 1-(4-bromophenoxy)-3,5-difluorobenzene. InChIKey: KYZVGEJLPAPBAK-UHFFFAOYSA-N.
| Molecular formula | C12H7BrF2O |
|---|---|
| Molecular weight | 285.08 g/mol |
| IUPAC name | 1-(4-bromophenoxy)-3,5-difluorobenzene |
| InChIKey | KYZVGEJLPAPBAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC(=CC(=C2)F)F)Br |
Computed by PubChem (NCBI)