CAS 2365471-31-2 is the registry number for JWH 018 N–(4,5–epoxypentyl) analog. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
Naphthalen-1-yl-[1-[3-(oxiran-2-yl)propyl]indol-3-yl]methanone (CAS 2365471-31-2) is a chemical compound with the molecular formula C24H21NO2 and a molecular weight of 355.4 g/mol. IUPAC name: naphthalen-1-yl-[1-[3-(oxiran-2-yl)propyl]indol-3-yl]methanone. InChIKey: WWVMNUMWFUXVSG-UHFFFAOYSA-N.
| Molecular formula | C24H21NO2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | naphthalen-1-yl-[1-[3-(oxiran-2-yl)propyl]indol-3-yl]methanone |
| InChIKey | WWVMNUMWFUXVSG-UHFFFAOYSA-N |
| SMILES | C1C(O1)CCCN2C=C(C3=CC=CC=C32)C(=O)C4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)