CAS 2365471-39-0 is the registry number for 5–fluoro ADB metabolite 7. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(2S)-2-[[1-(5-fluoropentyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid (CAS 2365471-39-0) is a chemical compound with the molecular formula C19H26FN3O3 and a molecular weight of 363.4 g/mol. IUPAC name: (2S)-2-[[1-(5-fluoropentyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid. InChIKey: MVDXLPCBCLGFHC-MRXNPFEDSA-N.
| Molecular formula | C19H26FN3O3 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | (2S)-2-[[1-(5-fluoropentyl)indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid |
| InChIKey | MVDXLPCBCLGFHC-MRXNPFEDSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CCCCCF |
Computed by PubChem (NCBI)