CAS 2365471-45-8 is the registry number for FUB–JWH 018. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
[1-[(4-fluorophenyl)methyl]indol-3-yl]-naphthalen-1-ylmethanone (CAS 2365471-45-8) is a chemical compound with the molecular formula C26H18FNO and a molecular weight of 379.4 g/mol. IUPAC name: [1-[(4-fluorophenyl)methyl]indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: VREQTLWJHFQLEX-UHFFFAOYSA-N.
| Molecular formula | C26H18FNO |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | [1-[(4-fluorophenyl)methyl]indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | VREQTLWJHFQLEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C3=CN(C4=CC=CC=C43)CC5=CC=C(C=C5)F |
Computed by PubChem (NCBI)