Products 2365471-47-0
CAS 2365471-47-0 appears in our catalog under these names: PX-2, PX 2. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 1mg, 10mg, 5mg.
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide (CAS 2365471-47-0) is a chemical compound with the molecular formula C22H25FN4O2 and a molecular weight of 396.5 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide. InChIKey: OJTAHWMZBJRSIR-SFHVURJKSA-N.
| Molecular formula | C22H25FN4O2 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide |
| InChIKey | OJTAHWMZBJRSIR-SFHVURJKSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)C2=NN(C3=CC=CC=C32)CCCCCF |
Computed by PubChem (NCBI)