CAS 2365471-50-5 is the registry number for XLR11 N–(4–fluoropentyl) isomer. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
[1-(4-fluoropentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (CAS 2365471-50-5) is a chemical compound with the molecular formula C21H28FNO and a molecular weight of 329.5 g/mol. IUPAC name: [1-(4-fluoropentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone. InChIKey: ROEZBBZNFJXHOC-UHFFFAOYSA-N.
| Molecular formula | C21H28FNO |
|---|---|
| Molecular weight | 329.5 g/mol |
| IUPAC name | [1-(4-fluoropentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| InChIKey | ROEZBBZNFJXHOC-UHFFFAOYSA-N |
| SMILES | CC(CCCN1C=C(C2=CC=CC=C21)C(=O)C3C(C3(C)C)(C)C)F |
Computed by PubChem (NCBI)