CAS 2365471-68-5 is the registry number for 5–fluoro ADB–PINACA isomer 2. Offered by: GLPBio. Available pack sizes: 5mg, 1mg, 50mg.
N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide (CAS 2365471-68-5) is a chemical compound with the molecular formula C19H27FN4O2 and a molecular weight of 362.4 g/mol. IUPAC name: N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide. InChIKey: BGRYUHNKCCAZCH-BBRMVZONSA-N.
| Molecular formula | C19H27FN4O2 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-1-(5-fluoropentyl)indazole-3-carboxamide |
| InChIKey | BGRYUHNKCCAZCH-BBRMVZONSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N)NC(=O)C1=NN(C2=CC=CC=C21)CCCCCF |
Computed by PubChem (NCBI)