Products 2366180-10-9
CAS 2366180-10-9 is the registry number for ((2R,6R)-6-(Trifluoromethyl)morpholin-2-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,6R)-6-(trifluoromethyl)morpholin-2-yl]methanol (CAS 2366180-10-9) is a chemical compound with the molecular formula C6H10F3NO2 and a molecular weight of 185.14 g/mol. IUPAC name: [(2R,6R)-6-(trifluoromethyl)morpholin-2-yl]methanol. InChIKey: ZBHWZKGOGDZROC-RFZPGFLSSA-N.
| Molecular formula | C6H10F3NO2 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | [(2R,6R)-6-(trifluoromethyl)morpholin-2-yl]methanol |
| InChIKey | ZBHWZKGOGDZROC-RFZPGFLSSA-N |
| SMILES | C1[C@@H](O[C@H](CN1)C(F)(F)F)CO |
Computed by PubChem (NCBI)