CAS 2366184-91-8 is the registry number for 3-Iodo-6-(trifluoromethyl)imidazo[1,2-b]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-iodo-6-(trifluoromethyl)imidazo[1,2-b]pyridazine (CAS 2366184-91-8) is a chemical compound with the molecular formula C7H3F3IN3 and a molecular weight of 313.02 g/mol. IUPAC name: 3-iodo-6-(trifluoromethyl)imidazo[1,2-b]pyridazine. InChIKey: SOEOSWPAGNHNOY-UHFFFAOYSA-N.
| Molecular formula | C7H3F3IN3 |
|---|---|
| Molecular weight | 313.02 g/mol |
| IUPAC name | 3-iodo-6-(trifluoromethyl)imidazo[1,2-b]pyridazine |
| InChIKey | SOEOSWPAGNHNOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2N=C1C(F)(F)F)I |
Computed by PubChem (NCBI)