Products 2366209-87-0
CAS 2366209-87-0 is the registry number for 7-(4-Chlorophenyl)-1-phenylnaphthalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(4-chlorophenyl)-1-phenylnaphthalene (CAS 2366209-87-0) is a chemical compound with the molecular formula C22H15Cl and a molecular weight of 314.8 g/mol. IUPAC name: 7-(4-chlorophenyl)-1-phenylnaphthalene. InChIKey: BYQDQOYMSWNEGF-UHFFFAOYSA-N.
| Molecular formula | C22H15Cl |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | 7-(4-chlorophenyl)-1-phenylnaphthalene |
| InChIKey | BYQDQOYMSWNEGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2C=C(C=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)