CAS 23666-04-8 is the registry number for Magnesium Ascorbyl Phosphate. Offered by: Chemat Brand. Available pack sizes: on request.
CAS 23666-04-8 identifies a chemical compound with the molecular formula C6H9MgO9P and a molecular weight of 280.41 g/mol. InChIKey: XYWDYAVMJYSSSG-LEJBHHMKSA-N.
| Molecular formula | C6H9MgO9P |
|---|---|
| Molecular weight | 280.41 g/mol |
| InChIKey | XYWDYAVMJYSSSG-LEJBHHMKSA-N |
| SMILES | C([C@@H]([C@@H]1C(=C(C(=O)O1)OP(=O)(O)O)O)O)O.[Mg] |
Computed by PubChem (NCBI)