CAS 23677-93-2 is the registry number for Bis(trifluoro–2,4–pentanedionato)copper(II). Offered by: GLPBio. Available pack sizes: 1g.
Copper bis((E)-1,1,1-trifluoro-4-oxopent-2-en-2-olate) (CAS 23677-93-2) is a chemical compound with the molecular formula C10H8CuF6O4 and a molecular weight of 369.70 g/mol. IUPAC name: copper bis((E)-1,1,1-trifluoro-4-oxopent-2-en-2-olate). InChIKey: GZVJAFMHAGQIEB-RIRHYHJESA-L.
| Molecular formula | C10H8CuF6O4 |
|---|---|
| Molecular weight | 369.70 g/mol |
| IUPAC name | copper bis((E)-1,1,1-trifluoro-4-oxopent-2-en-2-olate) |
| InChIKey | GZVJAFMHAGQIEB-RIRHYHJESA-L |
| SMILES | CC(=O)/C=C(/[O-])\C(F)(F)F.CC(=O)/C=C(/[O-])\C(F)(F)F.[Cu+2] |
Computed by PubChem (NCBI)