CAS 2368207-22-9 is the registry number for 7-Bromo-5-(difluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-(difluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (CAS 2368207-22-9) is a chemical compound with the molecular formula C7H5BrF2N4 and a molecular weight of 263.04 g/mol. IUPAC name: 7-bromo-5-(difluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine. InChIKey: VSCKZUNFCPXYPU-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF2N4 |
|---|---|
| Molecular weight | 263.04 g/mol |
| IUPAC name | 7-bromo-5-(difluoromethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| InChIKey | VSCKZUNFCPXYPU-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C1C(F)F)C(=NC=N2)N)Br |
Computed by PubChem (NCBI)