CAS 2368812-73-9 is the registry number for 2-Hydroxy Methyl Ester Bexarotene. Offered by: TRC. Available pack sizes: 100mg.
Methyl 4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoate (CAS 2368812-73-9) is a chemical compound with the molecular formula C25H32O3 and a molecular weight of 380.5 g/mol. IUPAC name: methyl 4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoate. InChIKey: DVRVRJDCCDPSHE-UHFFFAOYSA-N.
| Molecular formula | C25H32O3 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | methyl 4-[2-hydroxy-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethyl]benzoate |
| InChIKey | DVRVRJDCCDPSHE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(CO)C3=CC=C(C=C3)C(=O)OC)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)