CAS 2368829-32-5 appears in our catalog under these names: Sodium 1,3-benzoxazol-2-ylacetate hydrate, 95%, Sodium 2-(benzo(d)oxazol-2-yl)acetate hydrate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
Sodium;2-(1,3-benzoxazol-2-yl)acetate;hydrate (CAS 2368829-32-5) is a chemical compound with the molecular formula C9H8NNaO4 and a molecular weight of 217.15 g/mol. IUPAC name: sodium;2-(1,3-benzoxazol-2-yl)acetate;hydrate. InChIKey: FGNRYHLFDLPTBI-UHFFFAOYSA-M.
| Molecular formula | C9H8NNaO4 |
|---|---|
| Molecular weight | 217.15 g/mol |
| IUPAC name | sodium;2-(1,3-benzoxazol-2-yl)acetate;hydrate |
| InChIKey | FGNRYHLFDLPTBI-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)N=C(O2)CC(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)