CAS 2368888-61-1 is the registry number for 2,4,6-Tris[3-(bromomethyl)phenyl]-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4,6-tris[3-(bromomethyl)phenyl]-1,3,5-triazine (CAS 2368888-61-1) is a chemical compound with the molecular formula C24H18Br3N3 and a molecular weight of 588.1 g/mol. IUPAC name: 2,4,6-tris[3-(bromomethyl)phenyl]-1,3,5-triazine. InChIKey: GTWRFPMOXXQOOX-UHFFFAOYSA-N.
| Molecular formula | C24H18Br3N3 |
|---|---|
| Molecular weight | 588.1 g/mol |
| IUPAC name | 2,4,6-tris[3-(bromomethyl)phenyl]-1,3,5-triazine |
| InChIKey | GTWRFPMOXXQOOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC(=NC(=N2)C3=CC=CC(=C3)CBr)C4=CC=CC(=C4)CBr)CBr |
Computed by PubChem (NCBI)