CAS 1169964-41-3 appears in our catalog under these names: 1,3,5-Triazine, 2,4,6-tris[4-(bromomethyl)phenyl]-, 98%, 2,4,6–Tris(4–(bromomethyl)phenyl)–1,3,5–triazine, 2,4,6-Tris(4-(bromomethyl)phenyl)-1,3,5-triazine, 98%, 98%, 2,4,6-Tris(4-(bromomethyl)phenyl)-1,3,5-triazine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100mg.
2,4,6-tris[4-(bromomethyl)phenyl]-1,3,5-triazine (CAS 1169964-41-3) is a chemical compound with the molecular formula C24H18Br3N3 and a molecular weight of 588.1 g/mol. IUPAC name: 2,4,6-tris[4-(bromomethyl)phenyl]-1,3,5-triazine. InChIKey: IOJQCIAKNZPJAN-UHFFFAOYSA-N.
| Molecular formula | C24H18Br3N3 |
|---|---|
| Molecular weight | 588.1 g/mol |
| IUPAC name | 2,4,6-tris[4-(bromomethyl)phenyl]-1,3,5-triazine |
| InChIKey | IOJQCIAKNZPJAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)C2=NC(=NC(=N2)C3=CC=C(C=C3)CBr)C4=CC=C(C=C4)CBr |
Computed by PubChem (NCBI)