CAS 2368899-47-0 is the registry number for Crisaborole Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(1-methoxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile (CAS 2368899-47-0) is a chemical compound with the molecular formula C15H12BNO3 and a molecular weight of 265.07 g/mol. IUPAC name: 4-[(1-methoxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile. InChIKey: XVOUMRAHYCCSSI-UHFFFAOYSA-N.
| Molecular formula | C15H12BNO3 |
|---|---|
| Molecular weight | 265.07 g/mol |
| IUPAC name | 4-[(1-methoxy-3H-2,1-benzoxaborol-5-yl)oxy]benzonitrile |
| InChIKey | XVOUMRAHYCCSSI-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)OC3=CC=C(C=C3)C#N)OC |
Computed by PubChem (NCBI)