CAS 2368910-43-2 is the registry number for ((3S,4S)-4-Methoxy-1-methylpyrrolidin-3-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]methanol (CAS 2368910-43-2) is a chemical compound with the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. IUPAC name: [(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]methanol. InChIKey: QYJNPKQQSZKKIU-NKWVEPMBSA-N.
| Molecular formula | C7H15NO2 |
|---|---|
| Molecular weight | 145.20 g/mol |
| IUPAC name | [(3S,4S)-4-methoxy-1-methylpyrrolidin-3-yl]methanol |
| InChIKey | QYJNPKQQSZKKIU-NKWVEPMBSA-N |
| SMILES | CN1C[C@H]([C@@H](C1)OC)CO |
Computed by PubChem (NCBI)