CAS 2368911-04-8 is the registry number for Rel-(3R,4R)-4-(2,2-difluoroethoxy)-1-methylpyrrolidin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-4-(2,2-difluoroethoxy)-1-methylpyrrolidin-3-ol (CAS 2368911-04-8) is a chemical compound with the molecular formula C7H13F2NO2 and a molecular weight of 181.18 g/mol. IUPAC name: (3R,4R)-4-(2,2-difluoroethoxy)-1-methylpyrrolidin-3-ol. InChIKey: VEMMMKUHUDYFFR-PHDIDXHHSA-N.
| Molecular formula | C7H13F2NO2 |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | (3R,4R)-4-(2,2-difluoroethoxy)-1-methylpyrrolidin-3-ol |
| InChIKey | VEMMMKUHUDYFFR-PHDIDXHHSA-N |
| SMILES | CN1C[C@H]([C@@H](C1)OCC(F)F)O |
Computed by PubChem (NCBI)